(5-FLUORO-2-[4-(PROPAN-2-YL)PIPERAZIN-1-YL]PHENYL)METHANOL

pro_cas
pro_cdbregno
CCD01449397
pro_formula
C14 H21 F N2 O
pro_molWeight
252.331

basic_info

Product_Name: (5-FLUORO-2-[4-(PROPAN-2-YL)PIPERAZIN-1-YL]PHENYL)METHANOL
EnglishSynonyms: (5-FLUORO-2-[4-(PROPAN-2-YL)PIPERAZIN-1-YL]PHENYL)METHANOL
pro_mdlNumber: MFCD12078757
pro_acceptors: 3
pro_donors: 1
pro_smile: CC(C)N1CCN(CC1)c2ccc(cc2CO)F
InChi: InChI=1S/C14H21FN2O/c1-11(2)16-5-7-17(8-6-16)14-4-3-13(15)9-12(14)10-18/h3-4,9,11,18H,5-8,10H2,1-2H3
InChiKey: InChIKey=TXNBIWVYUBJVHO-UHFFFAOYSA-N