5-[(2,6-DIMETHYLMORPHOLIN-4-YL)CARBONYL]-1-(PROPAN-2-YL)-1H-PYRROL-3-AMINE

pro_cas
pro_cdbregno
CCD01701427
pro_formula
C14 H23 N3 O2
pro_molWeight
265.355

basic_info

Product_Name: 5-[(2,6-DIMETHYLMORPHOLIN-4-YL)CARBONYL]-1-(PROPAN-2-YL)-1H-PYRROL-3-AMINE
EnglishSynonyms: 5-[(2,6-DIMETHYLMORPHOLIN-4-YL)CARBONYL]-1-(PROPAN-2-YL)-1H-PYRROL-3-AMINE
pro_mdlNumber: MFCD12590528
pro_acceptors: 5
pro_donors: 1
pro_smile: CC1CN(CC(O1)C)C(=O)c2cc(cn2C(C)C)N
InChi: InChI=1S/C14H23N3O2/c1-9(2)17-8-12(15)5-13(17)14(18)16-6-10(3)19-11(4)7-16/h5,8-11H,6-7,15H2,1-4H3
InChiKey: InChIKey=MAGFABYXWYTQLR-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.