5-PHENYL-1-(PYRIDIN-2-YLMETHYL)-1H-IMIDAZOLE-2-THIOL

pro_cas
pro_cdbregno
CCD01727611
pro_formula
C15 H13 N3 S
pro_molWeight
267.355

basic_info

Product_Name: 5-PHENYL-1-(PYRIDIN-2-YLMETHYL)-1H-IMIDAZOLE-2-THIOL
EnglishSynonyms: 5-PHENYL-1-(PYRIDIN-2-YLMETHYL)-1H-IMIDAZOLE-2-THIOL
pro_mdlNumber: MFCD12633869
pro_acceptors: 3
pro_donors: 0
pro_smile: c1ccc(cc1)c2cnc(n2Cc3ccccn3)S
InChi: InChI=1S/C15H13N3S/c19-15-17-10-14(12-6-2-1-3-7-12)18(15)11-13-8-4-5-9-16-13/h1-10H,11H2,(H,17,19)
InChiKey: InChIKey=YRDMLEBMWJUNSK-UHFFFAOYSA-N