5-CHLORO-N-(3,4-DIMETHYLPHENYL)-1-METHYL-1H-IMIDAZOLE-4-SULFONAMIDE

pro_cas
pro_cdbregno
CCD01729295
pro_formula
C12 H14 Cl N3 O2 S
pro_molWeight
299.781

basic_info

Product_Name: 5-CHLORO-N-(3,4-DIMETHYLPHENYL)-1-METHYL-1H-IMIDAZOLE-4-SULFONAMIDE
EnglishSynonyms: 5-CHLORO-N-(3,4-DIMETHYLPHENYL)-1-METHYL-1H-IMIDAZOLE-4-SULFONAMIDE
pro_mdlNumber: MFCD12636059
pro_acceptors: 5
pro_donors: 1
pro_smile: Cc1ccc(cc1C)NS(=O)(=O)c2c(n(cn2)C)Cl
InChi: InChI=1S/C12H14ClN3O2S/c1-8-4-5-10(6-9(8)2)15-19(17,18)12-11(13)16(3)7-14-12/h4-7,15H,1-3H3
InChiKey: InChIKey=IOXLJMYBAHPKLA-UHFFFAOYSA-N