5-[(3,5-DIMETHYLPIPERIDIN-1-YL)CARBONYL]-1-(PROPAN-2-YL)-1H-PYRROL-3-AMINE

pro_cas
pro_cdbregno
CCD01766407
pro_formula
C15 H25 N3 O
pro_molWeight
263.383

basic_info

Product_Name: 5-[(3,5-DIMETHYLPIPERIDIN-1-YL)CARBONYL]-1-(PROPAN-2-YL)-1H-PYRROL-3-AMINE
EnglishSynonyms: 5-[(3,5-DIMETHYLPIPERIDIN-1-YL)CARBONYL]-1-(PROPAN-2-YL)-1H-PYRROL-3-AMINE
pro_mdlNumber: MFCD12693759
pro_acceptors: 4
pro_donors: 1
pro_smile: CC1CC(CN(C1)C(=O)c2cc(cn2C(C)C)N)C
InChi: InChI=1S/C15H25N3O/c1-10(2)18-9-13(16)6-14(18)15(19)17-7-11(3)5-12(4)8-17/h6,9-12H,5,7-8,16H2,1-4H3
InChiKey: InChIKey=WASAGAIZKXMECK-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.