5-CHLORO-2-(PIPERIDIN-3-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE

pro_cas
pro_cdbregno
CCD01779768
pro_formula
C15 H20 Cl N3
pro_molWeight
277.797

basic_info

Product_Name: 5-CHLORO-2-(PIPERIDIN-3-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE
EnglishSynonyms: 5-CHLORO-2-(PIPERIDIN-3-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE
pro_mdlNumber: MFCD12720880
pro_acceptors: 3
pro_donors: 1
pro_smile: CC(C)n1c2ccc(cc2nc1C3CCCNC3)Cl
InChi: InChI=1S/C15H20ClN3/c1-10(2)19-14-6-5-12(16)8-13(14)18-15(19)11-4-3-7-17-9-11/h5-6,8,10-11,17H,3-4,7,9H2,1-2H3
InChiKey: InChIKey=PZLDNIFENFWKCA-UHFFFAOYSA-N