5-CHLORO-2-(PIPERIDIN-4-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE

pro_cas
pro_cdbregno
CCD01779776
pro_formula
C15 H20 Cl N3
pro_molWeight
277.797

basic_info

Product_Name: 5-CHLORO-2-(PIPERIDIN-4-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE
EnglishSynonyms: 5-CHLORO-2-(PIPERIDIN-4-YL)-1-(PROPAN-2-YL)-1H-1,3-BENZODIAZOLE
pro_mdlNumber: MFCD12720890
pro_acceptors: 3
pro_donors: 1
pro_smile: CC(C)n1c2ccc(cc2nc1C3CCNCC3)Cl
InChi: InChI=1S/C15H20ClN3/c1-10(2)19-14-4-3-12(16)9-13(14)18-15(19)11-5-7-17-8-6-11/h3-4,9-11,17H,5-8H2,1-2H3
InChiKey: InChIKey=KOEIZRNYNAPQDW-UHFFFAOYSA-N