C14 H19 N O2


pro_mdlNumber: MFCD12755521
pro_acceptors: 3
pro_donors: 1
pro_smile: CCc1cccc(c1)[C@H]2CNC[C@@H]2C(=O)OC
InChi: InChI=1S/C14H19NO2/c1-3-10-5-4-6-11(7-10)12-8-15-9-13(12)14(16)17-2/h4-7,12-13,15H,3,8-9H2,1-2H3/t12-,13+/m1/s1

* If the product has intellectual property rights, a license granted is must or contact us.