TRANS-METHYL 4-(4-ETHYLPHENYL)PYRROLIDINE-3-CARBOXYLATE

pro_cas
pro_cdbregno
CCD01804711
pro_formula
C14 H19 N O2
pro_molWeight
233.309

basic_info

Product_Name: TRANS-METHYL 4-(4-ETHYLPHENYL)PYRROLIDINE-3-CARBOXYLATE
EnglishSynonyms: TRANS-METHYL 4-(4-ETHYLPHENYL)PYRROLIDINE-3-CARBOXYLATE
pro_mdlNumber: MFCD12755522
pro_acceptors: 3
pro_donors: 1
pro_smile: CCc1ccc(cc1)[C@H]2CNC[C@@H]2C(=O)OC
InChi: InChI=1S/C14H19NO2/c1-3-10-4-6-11(7-5-10)12-8-15-9-13(12)14(16)17-2/h4-7,12-13,15H,3,8-9H2,1-2H3/t12-,13+/m1/s1
InChiKey: InChIKey=JCSGJWKPOAXMPM-OLZOCXBDSA-N

* If the product has intellectual property rights, a license granted is must or contact us.