(3-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]PROPYL)(PROPAN-2-YL)AMINE

pro_cas
pro_cdbregno
CCD01855542
pro_formula
C13H25N3
pro_molWeight
223.361

basic_info

Product_Name: (3-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]PROPYL)(PROPAN-2-YL)AMINE
EnglishSynonyms: (3-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]PROPYL)(PROPAN-2-YL)AMINE
pro_mdlNumber: MFCD12807268
pro_acceptors: 3
pro_donors: 2
pro_smile: CC=1N=C(NC1C(C)C)CCCNC(C)C
InChi: InChI=1S/C13H25N3/c1-9(2)13-11(5)15-12(16-13)7-6-8-14-10(3)4/h9-10,14H,6-8H2,1-5H3,(H,15,16)
InChiKey: InChIKey=RPWSNGGHMOIXJM-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.