TERT-BUTYL((2-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL))AMINE

pro_cas
pro_cdbregno
CCD01855543
pro_formula
C13H25N3
pro_molWeight
223.361

basic_info

Product_Name: TERT-BUTYL((2-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL))AMINE
EnglishSynonyms: TERT-BUTYL((2-[4-METHYL-5-(PROPAN-2-YL)-1H-IMIDAZOL-2-YL]ETHYL))AMINE
pro_mdlNumber: MFCD12807269
pro_acceptors: 3
pro_donors: 2
pro_smile: C(C)(C)(C)NCCC=1NC(=C(N1)C)C(C)C
InChi: InChI=1S/C13H25N3/c1-9(2)12-10(3)15-11(16-12)7-8-14-13(4,5)6/h9,14H,7-8H2,1-6H3,(H,15,16)
InChiKey: InChIKey=YSYMVEBSYJPJKB-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.