PYRIMIDIN-2-YL(QUINOLIN-3-YL)METHANOL

pro_cas
pro_cdbregno
CCD01925658
pro_formula
C14 H11 N3 O
pro_molWeight
237.261

basic_info

Product_Name: PYRIMIDIN-2-YL(QUINOLIN-3-YL)METHANOL
EnglishSynonyms: PYRIMIDIN-2-YL(QUINOLIN-3-YL)METHANOL
pro_mdlNumber: MFCD12877757
pro_acceptors: 4
pro_donors: 1
pro_smile: c1ccc2c(c1)cc(cn2)C(c3ncccn3)O
InChi: InChI=1S/C14H11N3O/c18-13(14-15-6-3-7-16-14)11-8-10-4-1-2-5-12(10)17-9-11/h1-9,13,18H
InChiKey: InChIKey=RYTGTOORFQAYKL-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.