PYRIMIDIN-2-YL(QUINOLIN-3-YL)METHANAMINE

pro_cas
pro_cdbregno
CCD01925677
pro_formula
C14 H12 N4
pro_molWeight
236.277

basic_info

Product_Name: PYRIMIDIN-2-YL(QUINOLIN-3-YL)METHANAMINE
EnglishSynonyms: PYRIMIDIN-2-YL(QUINOLIN-3-YL)METHANAMINE
pro_mdlNumber: MFCD12877776
pro_acceptors: 4
pro_donors: 1
pro_smile: c1ccc2c(c1)cc(cn2)C(c3ncccn3)N
InChi: InChI=1S/C14H12N4/c15-13(14-16-6-3-7-17-14)11-8-10-4-1-2-5-12(10)18-9-11/h1-9,13H,15H2
InChiKey: InChIKey=WXHJWTUJNKBKOQ-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.