N-[NALPHA,NALPHA-BIS(CARBOXYMETHYL)-L-LYSINE]-12-MERCAPTODODECANAMIDE

pro_cas
681239-95-2
pro_cdbregno
CCD01960061
pro_formula
C22 H40 N2 O7 S
pro_molWeight
476.631

basic_info

Product_Name: N-[NALPHA,NALPHA-BIS(CARBOXYMETHYL)-L-LYSINE]-12-MERCAPTODODECANAMIDE
CAS: 681239-95-2
EnglishSynonyms: N-[NALPHA,NALPHA-BIS(CARBOXYMETHYL)-L-LYSINE]-12-MERCAPTODODECANAMIDE ; N2,N2-BIS(CARBOXYMETHYL)-N6-(12-MERCAPTO-1-OXODODECYL)-L-LYSINE
pro_mdlNumber: MFCD12912380
pro_acceptors: 9
pro_donors: 4
pro_smile: C(CCCCCC(=O)NCCCC[C@@H](C(=O)O)N(CC(=O)O)CC(=O)O)CCCCCS
InChi: InChI=1S/C22H40N2O7S/c25-19(13-8-6-4-2-1-3-5-7-11-15-32)23-14-10-9-12-18(22(30)31)24(16-20(26)27)17-21(28)29/h18,32H,1-17H2,(H,23,25)(H,26,27)(H,28,29)(H,30,31)/t18-/m0/s1
InChiKey: InChIKey=DFNBCRSGLOPDAH-SFHVURJKSA-N