PYRIDO[2,3-D]-1,2,3-TRIAZINE

pro_cas
6133-40-0
pro_cdbregno
CCD01991383
pro_formula
C6 H4 N4
pro_molWeight
132.126

basic_info

Product_Name: PYRIDO[2,3-D]-1,2,3-TRIAZINE
CAS: 6133-40-0
EnglishSynonyms: PYRIDO[2,3-D]-1,2,3-TRIAZINE
pro_mdlNumber: MFCD13175877
pro_acceptors: 4
pro_donors: 0
pro_smile: c1cc2cnnnc2nc1
InChi: InChI=1S/C6H4N4/c1-2-5-4-8-10-9-6(5)7-3-1/h1-4H
InChiKey: InChIKey=KNCXKNGZYFKVMP-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.