4(3H)-QUINAZOLINONE, 6-CHLORO-2-(1-METHYLETHENYL)-

pro_cas
943553-41-1
pro_cdbregno
CCD02008870
pro_formula
C11 H9 Cl N2 O
pro_molWeight
220.658

basic_info

Product_Name: 4(3H)-QUINAZOLINONE, 6-CHLORO-2-(1-METHYLETHENYL)-
CAS: 943553-41-1
EnglishSynonyms: 4(3H)-QUINAZOLINONE, 6-CHLORO-2-(1-METHYLETHENYL)- ; 6-CHLORO-2-(1-METHYLETHENYL)-4(3H)-QUINAZOLINONE
pro_mdlNumber: MFCD13193726
pro_acceptors: 3
pro_donors: 1
pro_smile: CC(=C)c1[nH]c2ccc(cc2c(=O)n1)Cl
InChi: InChI=1S/C11H9ClN2O/c1-6(2)10-13-9-4-3-7(12)5-8(9)11(15)14-10/h3-5H,1H2,2H3,(H,13,14,15)
InChiKey: InChIKey=MOXVKGQQGUSNDD-UHFFFAOYSA-N