7-(2-(METHYLTHIO)PYRIMIDIN-4-YL)-1H-IMIDAZO[1,2-B]PYRAZOLE

pro_cas
956722-15-9
pro_cdbregno
CCD02010534
pro_formula
C10 H9 N5 S
pro_molWeight
231.282

basic_info

Product_Name: 7-(2-(METHYLTHIO)PYRIMIDIN-4-YL)-1H-IMIDAZO[1,2-B]PYRAZOLE
CAS: 956722-15-9
EnglishSynonyms: 7-(2-(METHYLTHIO)PYRIMIDIN-4-YL)-1H-IMIDAZO[1,2-B]PYRAZOLE
pro_mdlNumber: MFCD13195409
pro_acceptors: 5
pro_donors: 1
pro_smile: CSc1nccc(n1)c2cnn3c2[nH]cc3
InChi: InChI=1S/C10H9N5S/c1-16-10-12-3-2-8(14-10)7-6-13-15-5-4-11-9(7)15/h2-6,11H,1H3
InChiKey: InChIKey=XLASCKRLHQBEJU-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.