ETHYL 2-CYCLOPENTYLTHIAZOLE-4-CARBOXYLATE

pro_cas
955399-74-3
pro_cdbregno
CCD02010539
pro_formula
C11 H15 N O2 S
pro_molWeight
225.311

basic_info

Product_Name: ETHYL 2-CYCLOPENTYLTHIAZOLE-4-CARBOXYLATE
CAS: 955399-74-3
EnglishSynonyms: ETHYL 2-CYCLOPENTYLTHIAZOLE-4-CARBOXYLATE
pro_mdlNumber: MFCD13195414
pro_acceptors: 3
pro_donors: 0
pro_smile: CCOC(=O)c1csc(n1)C2CCCC2
InChi: InChI=1S/C11H15NO2S/c1-2-14-11(13)9-7-15-10(12-9)8-5-3-4-6-8/h7-8H,2-6H2,1H3
InChiKey: InChIKey=QDXXBMMHWODBSF-UHFFFAOYSA-N