BENZYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE

pro_cas
pro_cdbregno
CCD02013027
pro_formula
C16 H15 N O2
pro_molWeight
253.299

basic_info

Product_Name: BENZYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE
EnglishSynonyms: BENZYL 2,3-DIHYDRO-1H-INDOLE-5-CARBOXYLATE
pro_mdlNumber: MFCD13198071
pro_acceptors: 3
pro_donors: 1
pro_smile: c1ccc(cc1)COC(=O)c2ccc3c(c2)CCN3
InChi: InChI=1S/C16H15NO2/c18-16(19-11-12-4-2-1-3-5-12)14-6-7-15-13(10-14)8-9-17-15/h1-7,10,17H,8-9,11H2
InChiKey: InChIKey=UGMFTFODNNGQDZ-UHFFFAOYSA-N