N-[1-(FURAN-2-YL)ETHYL]-N-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE

pro_cas
pro_cdbregno
CCD02081406
pro_formula
C14 H22 N2 O
pro_molWeight
234.341

basic_info

Product_Name: N-[1-(FURAN-2-YL)ETHYL]-N-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
EnglishSynonyms: N-[1-(FURAN-2-YL)ETHYL]-N-METHYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
pro_mdlNumber: MFCD13291341
pro_acceptors: 3
pro_donors: 1
pro_smile: CC(c1ccco1)N(C)C2CC3CCC(C2)N3
InChi: InChI=1S/C14H22N2O/c1-10(14-4-3-7-17-14)16(2)13-8-11-5-6-12(9-13)15-11/h3-4,7,10-13,15H,5-6,8-9H2,1-2H3
InChiKey: InChIKey=STENFVPXHQPFOR-UHFFFAOYSA-N