N-CYCLOHEXYL-N-PROPYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE

pro_cas
pro_cdbregno
CCD02081789
pro_formula
C16 H30 N2
pro_molWeight
250.427

basic_info

Product_Name: N-CYCLOHEXYL-N-PROPYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
EnglishSynonyms: N-CYCLOHEXYL-N-PROPYL-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE
pro_mdlNumber: MFCD13291725
pro_acceptors: 2
pro_donors: 1
pro_smile: CCCN(C1CCCCC1)C2CC3CCC(C2)N3
InChi: InChI=1S/C16H30N2/c1-2-10-18(15-6-4-3-5-7-15)16-11-13-8-9-14(12-16)17-13/h13-17H,2-12H2,1H3
InChiKey: InChIKey=KJLUJAVYQKBSNQ-UHFFFAOYSA-N