7-FLUORONAPHTHALEN-1-YL TRIFLUOROMETHANESULFONATE

pro_cas
pro_cdbregno
CCD02191081
pro_formula
C11 H6 F4 O3 S
pro_molWeight
294.223

basic_info

Product_Name: 7-FLUORONAPHTHALEN-1-YL TRIFLUOROMETHANESULFONATE
EnglishSynonyms: 7-FLUORONAPHTHALEN-1-YL TRIFLUOROMETHANESULFONATE
pro_mdlNumber: MFCD13659280
pro_acceptors: 3
pro_donors: 0
pro_smile: c1cc2ccc(cc2c(c1)OS(=O)(=O)C(F)(F)F)F
InChi: InChI=1S/C11H6F4O3S/c12-8-5-4-7-2-1-3-10(9(7)6-8)18-19(16,17)11(13,14)15/h1-6H
InChiKey: InChIKey=ZMEBQXHLSSGVOG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.