3-[(5-AMINO-6-METHYLPYRIDIN-2-YL)AMINO]PROPANOIC ACID

pro_cas
pro_cdbregno
CCD02220418
pro_formula
C9 H13 N3 O2
pro_molWeight
195.221

basic_info

Product_Name: 3-[(5-AMINO-6-METHYLPYRIDIN-2-YL)AMINO]PROPANOIC ACID
EnglishSynonyms: 3-[(5-AMINO-6-METHYLPYRIDIN-2-YL)AMINO]PROPANOIC ACID
pro_mdlNumber: MFCD14548064
pro_acceptors: 5
pro_donors: 3
pro_smile: Cc1c(ccc(n1)NCCC(=O)O)N
InChi: InChI=1S/C9H13N3O2/c1-6-7(10)2-3-8(12-6)11-5-4-9(13)14/h2-3H,4-5,10H2,1H3,(H,11,12)(H,13,14)
InChiKey: InChIKey=VDVJOZXUGHFVPI-UHFFFAOYSA-N