3-[(5-OXOHEXYL)(PHENYL)AMINO]PROPANENITRILE

pro_cas
pro_cdbregno
CCD02479229
pro_formula
C15 H20 N2 O
pro_molWeight
244.336

basic_info

Product_Name: 3-[(5-OXOHEXYL)(PHENYL)AMINO]PROPANENITRILE
EnglishSynonyms: 3-[(5-OXOHEXYL)(PHENYL)AMINO]PROPANENITRILE
pro_mdlNumber: MFCD15516135
pro_acceptors: 3
pro_donors: 0
pro_smile: CC(=O)CCCCN(CCC#N)c1ccccc1
InChi: InChI=1S/C15H20N2O/c1-14(18)8-5-6-12-17(13-7-11-16)15-9-3-2-4-10-15/h2-4,9-10H,5-8,12-13H2,1H3
InChiKey: InChIKey=BURFYAMUIGXMMG-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.