4-(5-AMINO-6-METHYLPYRIDIN-2-YL)PIPERIDIN-2-ONE

pro_cas
pro_cdbregno
CCD02491132
pro_formula
C11 H15 N3 O
pro_molWeight
205.26

basic_info

Product_Name: 4-(5-AMINO-6-METHYLPYRIDIN-2-YL)PIPERIDIN-2-ONE
EnglishSynonyms: 4-(5-AMINO-6-METHYLPYRIDIN-2-YL)PIPERIDIN-2-ONE
pro_mdlNumber: MFCD15528045
pro_acceptors: 4
pro_donors: 2
pro_smile: Cc1c(ccc(n1)C2CCNC(=O)C2)N
InChi: InChI=1S/C11H15N3O/c1-7-9(12)2-3-10(14-7)8-4-5-13-11(15)6-8/h2-3,8H,4-6,12H2,1H3,(H,13,15)
InChiKey: InChIKey=CQHUUPMRKMBNTB-UHFFFAOYSA-N