2-HYDROXY-1-PHENYLPROPAN-1-ONE

pro_cas
pro_cdbregno
CCD02627107
pro_formula
C9 H10 O2
pro_molWeight
150.176

basic_info

Product_Name: 2-HYDROXY-1-PHENYLPROPAN-1-ONE
EnglishSynonyms: 2-HYDROXY-1-PHENYLPROPAN-1-ONE ; 2-HYDROXYPROPIOPHENONE
pro_mdlNumber: MFCD16165822
pro_acceptors: 2
pro_donors: 1
pro_smile: CC(C(=O)c1ccccc1)O
InChi: InChI=1S/C9H10O2/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,10H,1H3
InChiKey: InChIKey=WLVPRARCUSRDNI-UHFFFAOYSA-N