4-[(1-METHYLPYRROLIDIN-3-YL)AMINO]BENZENE-1-SULFONAMIDE

pro_cas
pro_cdbregno
CCD02638712
pro_formula
C11 H17 N3 O2 S
pro_molWeight
255.34

basic_info

Product_Name: 4-[(1-METHYLPYRROLIDIN-3-YL)AMINO]BENZENE-1-SULFONAMIDE
EnglishSynonyms: 4-[(1-METHYLPYRROLIDIN-3-YL)AMINO]BENZENE-1-SULFONAMIDE
pro_mdlNumber: MFCD16177455
pro_acceptors: 5
pro_donors: 2
pro_smile: CN1CCC(C1)Nc2ccc(cc2)S(=O)(=O)N
InChi: InChI=1S/C11H17N3O2S/c1-14-7-6-10(8-14)13-9-2-4-11(5-3-9)17(12,15)16/h2-5,10,13H,6-8H2,1H3,(H2,12,15,16)
InChiKey: InChIKey=SIBHWKZBNSGWLP-UHFFFAOYSA-N

* If the product has intellectual property rights, a license granted is must or contact us.