ETHYL 5-METHYLSULFANYLPYRIMIDINE-4-CARBOXYLATE

pro_cas
64224-61-9
pro_cdbregno
CCD03040587
pro_formula
C8 H10 N2 O2 S
pro_molWeight
198.245

basic_info

Product_Name: ETHYL 5-METHYLSULFANYLPYRIMIDINE-4-CARBOXYLATE
CAS: 64224-61-9
EnglishSynonyms: ETHYL 5-METHYLSULFANYLPYRIMIDINE-4-CARBOXYLATE
pro_mdlNumber: MFCD16660481
pro_acceptors: 4
pro_donors: 0
pro_smile: CCOC(=O)c1c(cncn1)SC
InChi: InChI=1S/C8H10N2O2S/c1-3-12-8(11)7-6(13-2)4-9-5-10-7/h4-5H,3H2,1-2H3
InChiKey: InChIKey=OLDAOEDKIRWMRF-UHFFFAOYSA-N

property

secure_info