ALPHA,ALPHA,3,5-TETRAMETHYL-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
1247097-35-3
pro_cdbregno
CCD03136874
pro_formula
C14 H20 O2
pro_molWeight
220.31

basic_info

Product_Name: ALPHA,ALPHA,3,5-TETRAMETHYL-BENZENEACETIC ACID, ETHYL ESTER
CAS: 1247097-35-3
EnglishSynonyms: BENZENEACETIC ACID, ALPHA,ALPHA,3,5-TETRAMETHYL-, ETHYL ESTER ; ALPHA,ALPHA,3,5-TETRAMETHYL-BENZENEACETIC ACID, ETHYL ESTER ; ETHYL 2-(3,5-DIMETHYLPHENYL)-2-METHYLPROPANOATE
pro_mdlNumber: MFCD16756780
pro_acceptors: 2
pro_donors: 0
pro_smile: CCOC(=O)C(C)(C)c1cc(cc(c1)C)C
InChi: InChI=1S/C14H20O2/c1-6-16-13(15)14(4,5)12-8-10(2)7-11(3)9-12/h7-9H,6H2,1-5H3
InChiKey: InChIKey=BUJHIIOVEXDRRS-UHFFFAOYSA-N