ALPHA-ETHYL-3,5-DIMETHYL-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
193095-52-2
pro_cdbregno
CCD03136875
pro_formula
C14 H20 O2
pro_molWeight
220.31

basic_info

Product_Name: ALPHA-ETHYL-3,5-DIMETHYL-BENZENEACETIC ACID, ETHYL ESTER
CAS: 193095-52-2
EnglishSynonyms: ETHYL 2-(3,5-DIMETHYLPHENYL)BUTANOATE ; ALPHA-ETHYL-3,5-DIMETHYL-BENZENEACETIC ACID, ETHYL ESTER ; BENZENEACETIC ACID, ALPHA-ETHYL-3,5-DIMETHYL-, ETHYL ESTER
pro_mdlNumber: MFCD16756781
pro_acceptors: 2
pro_donors: 0
pro_smile: CCC(c1cc(cc(c1)C)C)C(=O)OCC
InChi: InChI=1S/C14H20O2/c1-5-13(14(15)16-6-2)12-8-10(3)7-11(4)9-12/h7-9,13H,5-6H2,1-4H3
InChiKey: InChIKey=SNANHVBSNOEKTJ-UHFFFAOYSA-N