METHYL 2-(QUINOLIN-3-YL)PROPANOATE

pro_cas
154369-17-2
pro_cdbregno
CCD03136877
pro_formula
C13 H13 N O2
pro_molWeight
215.251

basic_info

Product_Name: METHYL 2-(QUINOLIN-3-YL)PROPANOATE
CAS: 154369-17-2
EnglishSynonyms: METHYL 2-(QUINOLIN-3-YL)PROPANOATE
pro_mdlNumber: MFCD16756783
pro_acceptors: 3
pro_donors: 0
pro_smile: CC(c1cc2ccccc2nc1)C(=O)OC
InChi: InChI=1S/C13H13NO2/c1-9(13(15)16-2)11-7-10-5-3-4-6-12(10)14-8-11/h3-9H,1-2H3
InChiKey: InChIKey=KQOSNSIBEYFGKI-UHFFFAOYSA-N