C14 H20 O2


CAS: 1195699-50-3
pro_mdlNumber: MFCD16756785
pro_acceptors: 2
pro_donors: 0
pro_smile: CCOC(=O)C(c1ccc(cc1)C)C(C)C
InChi: InChI=1S/C14H20O2/c1-5-16-14(15)13(10(2)3)12-8-6-11(4)7-9-12/h6-10,13H,5H2,1-4H3