1-NAPHTHALENEACETIC ACID, ALPHA-ETHYL-

pro_cas
15410-62-5
pro_cdbregno
CCD03136883
pro_formula
C14 H14 O2
pro_molWeight
214.263

basic_info

Product_Name: 1-NAPHTHALENEACETIC ACID, ALPHA-ETHYL-
CAS: 15410-62-5
EnglishSynonyms: 2-(NAPHTHALEN-1-YL)BUTANOIC ACID ; ALPHA-ETHYL-1-NAPHTHALENEACETIC ACID ; 1-NAPHTHALENEACETIC ACID, ALPHA-ETHYL-
pro_mdlNumber: MFCD16756789
pro_acceptors: 2
pro_donors: 1
pro_smile: CCC(c1cccc2c1cccc2)C(=O)O
InChi: InChI=1S/C14H14O2/c1-2-11(14(15)16)13-9-5-7-10-6-3-4-8-12(10)13/h3-9,11H,2H2,1H3,(H,15,16)
InChiKey: InChIKey=QHYDAWFCHGDWNR-UHFFFAOYSA-N