2,3-DICHLORO-ALPHA-ETHYL-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
1247480-42-7
pro_cdbregno
CCD03136885
pro_formula
C12 H14 Cl2 O2
pro_molWeight
261.147

basic_info

Product_Name: 2,3-DICHLORO-ALPHA-ETHYL-BENZENEACETIC ACID, ETHYL ESTER
CAS: 1247480-42-7
EnglishSynonyms: BENZENEACETIC ACID, 2,3-DICHLORO-ALPHA-ETHYL-, ETHYL ESTER ; 2,3-DICHLORO-ALPHA-ETHYL-BENZENEACETIC ACID, ETHYL ESTER ; ETHYL 2-(2,3-DICHLOROPHENYL)BUTANOATE
pro_mdlNumber: MFCD16756791
pro_acceptors: 2
pro_donors: 0
pro_smile: CCC(c1cccc(c1Cl)Cl)C(=O)OCC
InChi: InChI=1S/C12H14Cl2O2/c1-3-8(12(15)16-4-2)9-6-5-7-10(13)11(9)14/h5-8H,3-4H2,1-2H3
InChiKey: InChIKey=NSFLRLQWEWZFJC-UHFFFAOYSA-N