METHYL 2-(2,3-DICHLOROPHENYL)-3-METHYLBUTANOATE

pro_cas
1249879-01-3
pro_cdbregno
CCD03136886
pro_formula
C12 H14 Cl2 O2
pro_molWeight
261.147

basic_info

Product_Name: METHYL 2-(2,3-DICHLOROPHENYL)-3-METHYLBUTANOATE
CAS: 1249879-01-3
EnglishSynonyms: METHYL 2-(2,3-DICHLOROPHENYL)-3-METHYLBUTANOATE
pro_mdlNumber: MFCD16756792
pro_acceptors: 2
pro_donors: 0
pro_smile: CC(C)C(c1cccc(c1Cl)Cl)C(=O)OC
InChi: InChI=1S/C12H14Cl2O2/c1-7(2)10(12(15)16-3)8-5-4-6-9(13)11(8)14/h4-7,10H,1-3H3
InChiKey: InChIKey=WZZBSTBMKIAOPQ-UHFFFAOYSA-N