C12 H14 F2 O2


CAS: 1248724-45-9
pro_mdlNumber: MFCD16756793
pro_acceptors: 2
pro_donors: 0
pro_smile: CCOC(=O)C(C)(C)c1cc(cc(c1)F)F
InChi: InChI=1S/C12H14F2O2/c1-4-16-11(15)12(2,3)8-5-9(13)7-10(14)6-8/h5-7H,4H2,1-3H3