ALPHA-ETHYL-3,5-DIFLUORO-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
1250535-56-8
pro_cdbregno
CCD03136888
pro_formula
C12 H14 F2 O2
pro_molWeight
228.237

basic_info

Product_Name: ALPHA-ETHYL-3,5-DIFLUORO-BENZENEACETIC ACID, ETHYL ESTER
CAS: 1250535-56-8
EnglishSynonyms: ETHYL 2-(3,5-DIFLUOROPHENYL)BUTANOATE ; BENZENEACETIC ACID, ALPHA-ETHYL-3,5-DIFLUORO-, ETHYL ESTER ; ALPHA-ETHYL-3,5-DIFLUORO-BENZENEACETIC ACID, ETHYL ESTER
pro_mdlNumber: MFCD16756794
pro_acceptors: 2
pro_donors: 0
pro_smile: CCC(c1cc(cc(c1)F)F)C(=O)OCC
InChi: InChI=1S/C12H14F2O2/c1-3-11(12(15)16-4-2)8-5-9(13)7-10(14)6-8/h5-7,11H,3-4H2,1-2H3
InChiKey: InChIKey=VFVOHHPHMQDSAH-UHFFFAOYSA-N