3,5-DIFLUORO-ALPHA-(1-METHYLETHYL)-BENZENEACETIC ACID, METHYL ESTER

pro_cas
1248685-13-3
pro_cdbregno
CCD03136889
pro_formula
C12 H14 F2 O2
pro_molWeight
228.237

basic_info

Product_Name: 3,5-DIFLUORO-ALPHA-(1-METHYLETHYL)-BENZENEACETIC ACID, METHYL ESTER
CAS: 1248685-13-3
EnglishSynonyms: 3,5-DIFLUORO-ALPHA-(1-METHYLETHYL)-BENZENEACETIC ACID, METHYL ESTER ; METHYL 2-(3,5-DIFLUOROPHENYL)-3-METHYLBUTANOATE ; BENZENEACETIC ACID, 3,5-DIFLUORO-ALPHA-(1-METHYLETHYL)-, METHYL ESTER
pro_mdlNumber: MFCD16756795
pro_acceptors: 2
pro_donors: 0
pro_smile: CC(C)C(c1cc(cc(c1)F)F)C(=O)OC
InChi: InChI=1S/C12H14F2O2/c1-7(2)11(12(15)16-3)8-4-9(13)6-10(14)5-8/h4-7,11H,1-3H3
InChiKey: InChIKey=ZCUVWGXPOCWXLG-UHFFFAOYSA-N