ALPHA-ETHYL-2-METHOXY-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
1248474-12-5
pro_cdbregno
CCD03136893
pro_formula
C13 H18 O3
pro_molWeight
222.282

basic_info

Product_Name: ALPHA-ETHYL-2-METHOXY-BENZENEACETIC ACID, ETHYL ESTER
CAS: 1248474-12-5
EnglishSynonyms: ALPHA-ETHYL-2-METHOXY-BENZENEACETIC ACID, ETHYL ESTER ; ETHYL 2-(2-METHOXYPHENYL)BUTANOATE ; BENZENEACETIC ACID, ALPHA-ETHYL-2-METHOXY-, ETHYL ESTER
pro_mdlNumber: MFCD16756799
pro_acceptors: 3
pro_donors: 0
pro_smile: CCC(c1ccccc1OC)C(=O)OCC
InChi: InChI=1S/C13H18O3/c1-4-10(13(14)16-5-2)11-8-6-7-9-12(11)15-3/h6-10H,4-5H2,1-3H3
InChiKey: InChIKey=TVGFWBRRIATSNV-UHFFFAOYSA-N