4-FLUORO-ALPHA-(1-METHYLETHYL)-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
191332-14-6
pro_cdbregno
CCD03136899
pro_formula
C13 H17 F O2
pro_molWeight
224.273

basic_info

Product_Name: 4-FLUORO-ALPHA-(1-METHYLETHYL)-BENZENEACETIC ACID, ETHYL ESTER
CAS: 191332-14-6
EnglishSynonyms: 4-FLUORO-ALPHA-(1-METHYLETHYL)-BENZENEACETIC ACID, ETHYL ESTER ; ETHYL 2-(4-FLUOROPHENYL)-3-METHYLBUTANOATE ; BENZENEACETIC ACID, 4-FLUORO-ALPHA-(1-METHYLETHYL)-, ETHYL ESTER
pro_mdlNumber: MFCD16756805
pro_acceptors: 2
pro_donors: 0
pro_smile: CCOC(=O)C(c1ccc(cc1)F)C(C)C
InChi: InChI=1S/C13H17FO2/c1-4-16-13(15)12(9(2)3)10-5-7-11(14)8-6-10/h5-9,12H,4H2,1-3H3
InChiKey: InChIKey=VVPWURZURLTWNK-UHFFFAOYSA-N