ETHYL 2-(5-FLUORO-2-METHYLPHENYL)-2-METHYLPROPANOATE

pro_cas
1248441-45-3
pro_cdbregno
CCD03136900
pro_formula
C13 H17 F O2
pro_molWeight
224.273

basic_info

Product_Name: ETHYL 2-(5-FLUORO-2-METHYLPHENYL)-2-METHYLPROPANOATE
CAS: 1248441-45-3
EnglishSynonyms: ETHYL 2-(5-FLUORO-2-METHYLPHENYL)-2-METHYLPROPANOATE
pro_mdlNumber: MFCD16756806
pro_acceptors: 2
pro_donors: 0
pro_smile: CCOC(=O)C(C)(C)c1cc(ccc1C)F
InChi: InChI=1S/C13H17FO2/c1-5-16-12(15)13(3,4)11-8-10(14)7-6-9(11)2/h6-8H,5H2,1-4H3
InChiKey: InChIKey=YNVVKSPXEKPGRA-UHFFFAOYSA-N