ALPHA-ETHYL-5-FLUORO-2-METHYL-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
1250713-23-5
pro_cdbregno
CCD03136901
pro_formula
C13 H17 F O2
pro_molWeight
224.273

basic_info

Product_Name: ALPHA-ETHYL-5-FLUORO-2-METHYL-BENZENEACETIC ACID, ETHYL ESTER
CAS: 1250713-23-5
EnglishSynonyms: BENZENEACETIC ACID, ALPHA-ETHYL-5-FLUORO-2-METHYL-, ETHYL ESTER ; ETHYL 2-(5-FLUORO-2-METHYLPHENYL)BUTANOATE ; ALPHA-ETHYL-5-FLUORO-2-METHYL-BENZENEACETIC ACID, ETHYL ESTER
pro_mdlNumber: MFCD16756807
pro_acceptors: 2
pro_donors: 0
pro_smile: CCC(c1cc(ccc1C)F)C(=O)OCC
InChi: InChI=1S/C13H17FO2/c1-4-11(13(15)16-5-2)12-8-10(14)7-6-9(12)3/h6-8,11H,4-5H2,1-3H3
InChiKey: InChIKey=SKPCZRKFCWQIOI-UHFFFAOYSA-N