ALPHA-ETHYL-4-METHOXY-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
155407-25-3
pro_cdbregno
CCD03136905
pro_formula
C13 H18 O3
pro_molWeight
222.282

basic_info

Product_Name: ALPHA-ETHYL-4-METHOXY-BENZENEACETIC ACID, ETHYL ESTER
CAS: 155407-25-3
EnglishSynonyms: ALPHA-ETHYL-4-METHOXY-BENZENEACETIC ACID, ETHYL ESTER ; ETHYL 2-(4-METHOXYPHENYL)BUTANOATE ; BENZENEACETIC ACID, ALPHA-ETHYL-4-METHOXY-, ETHYL ESTER
pro_mdlNumber: MFCD16756811
pro_acceptors: 3
pro_donors: 0
pro_smile: CCC(c1ccc(cc1)OC)C(=O)OCC
InChi: InChI=1S/C13H18O3/c1-4-12(13(14)16-5-2)10-6-8-11(15-3)9-7-10/h6-9,12H,4-5H2,1-3H3
InChiKey: InChIKey=KNMAZEJFGKGGNT-UHFFFAOYSA-N