ALPHA-ETHYL-3-METHOXY-BENZENEACETIC ACID, ETHYL ESTER

pro_cas
149490-72-2
pro_cdbregno
CCD03136921
pro_formula
C13 H18 O3
pro_molWeight
222.282

basic_info

Product_Name: ALPHA-ETHYL-3-METHOXY-BENZENEACETIC ACID, ETHYL ESTER
CAS: 149490-72-2
EnglishSynonyms: ETHYL 2-(3-METHOXYPHENYL)BUTANOATE ; ALPHA-ETHYL-3-METHOXY-BENZENEACETIC ACID, ETHYL ESTER ; BENZENEACETIC ACID, ALPHA-ETHYL-3-METHOXY-, ETHYL ESTER
pro_mdlNumber: MFCD16756827
pro_acceptors: 3
pro_donors: 0
pro_smile: CCC(c1cccc(c1)OC)C(=O)OCC
InChi: InChI=1S/C13H18O3/c1-4-12(13(14)16-5-2)10-7-6-8-11(9-10)15-3/h6-9,12H,4-5H2,1-3H3
InChiKey: InChIKey=FVSAVEXGQDHTRG-UHFFFAOYSA-N