ETHYL 2-(2-CHLOROPHENYL)-3-METHYLBUTANOATE

pro_cas
1249399-97-0
pro_cdbregno
CCD03136924
pro_formula
C13 H17 Cl O2
pro_molWeight
240.728

basic_info

Product_Name: ETHYL 2-(2-CHLOROPHENYL)-3-METHYLBUTANOATE
CAS: 1249399-97-0
EnglishSynonyms: ETHYL 2-(2-CHLOROPHENYL)-3-METHYLBUTANOATE
pro_mdlNumber: MFCD16756830
pro_acceptors: 2
pro_donors: 0
pro_smile: CCOC(=O)C(c1ccccc1Cl)C(C)C
InChi: InChI=1S/C13H17ClO2/c1-4-16-13(15)12(9(2)3)10-7-5-6-8-11(10)14/h5-9,12H,4H2,1-3H3
InChiKey: InChIKey=QFFRNUXSKAUWLO-UHFFFAOYSA-N