5-(2-METHOXY-5-METHYLPHENYL)-1,3,4-OXADIAZOL-2-AMINE

pro_cas
1248905-09-0
pro_cdbregno
CCD03161102
pro_formula
C10 H11 N3 O2
pro_molWeight
205.216

basic_info

Product_Name: 5-(2-METHOXY-5-METHYLPHENYL)-1,3,4-OXADIAZOL-2-AMINE
CAS: 1248905-09-0
EnglishSynonyms: 5-(2-METHOXY-5-METHYLPHENYL)-1,3,4-OXADIAZOL-2-AMINE
pro_mdlNumber: MFCD16781008
pro_acceptors: 5
pro_donors: 1
pro_smile: Cc1ccc(c(c1)c2nnc(o2)N)OC
InChi: InChI=1S/C10H11N3O2/c1-6-3-4-8(14-2)7(5-6)9-12-13-10(11)15-9/h3-5H,1-2H3,(H2,11,13)
InChiKey: InChIKey=MNQMLUVYRUUBCW-UHFFFAOYSA-N