5-(3-CHLOROBENZYL)-1,3,4-OXADIAZOL-2-AMINE

pro_cas
1249790-26-8
pro_cdbregno
CCD03161154
pro_formula
C9 H8 Cl N3 O
pro_molWeight
209.635

basic_info

Product_Name: 5-(3-CHLOROBENZYL)-1,3,4-OXADIAZOL-2-AMINE
CAS: 1249790-26-8
EnglishSynonyms: 5-(3-CHLOROBENZYL)-1,3,4-OXADIAZOL-2-AMINE ; 5-[(3-CHLOROPHENYL)METHYL]-1,3,4-OXADIAZOL-2-AMINE
pro_mdlNumber: MFCD16781060
pro_acceptors: 4
pro_donors: 1
pro_smile: c1cc(cc(c1)Cl)Cc2nnc(o2)N
InChi: InChI=1S/C9H8ClN3O/c10-7-3-1-2-6(4-7)5-8-12-13-9(11)14-8/h1-4H,5H2,(H2,11,13)
InChiKey: InChIKey=IFWSJWLOILHCRB-UHFFFAOYSA-N