(1-((6-CHLOROPYRIMIDIN-4-YL)AMINO)CYCLOPENTYL)METHANOL

pro_cas
1249011-39-9
pro_cdbregno
CCD03165609
pro_formula
C10 H14 Cl N3 O
pro_molWeight
227.694

basic_info

Product_Name: (1-((6-CHLOROPYRIMIDIN-4-YL)AMINO)CYCLOPENTYL)METHANOL
CAS: 1249011-39-9
EnglishSynonyms: (1-((6-CHLOROPYRIMIDIN-4-YL)AMINO)CYCLOPENTYL)METHANOL
pro_mdlNumber: MFCD16785515
pro_acceptors: 4
pro_donors: 2
pro_smile: c1c(ncnc1Cl)NC2(CCCC2)CO
InChi: InChI=1S/C10H14ClN3O/c11-8-5-9(13-7-12-8)14-10(6-15)3-1-2-4-10/h5,7,15H,1-4,6H2,(H,12,13,14)
InChiKey: InChIKey=KYIDFCFFGFBSDC-UHFFFAOYSA-N