(1-((6-CHLOROPYRIMIDIN-4-YL)AMINO)CYCLOHEXYL)METHANOL

pro_cas
1250521-81-3
pro_cdbregno
CCD03166261
pro_formula
C11 H16 Cl N3 O
pro_molWeight
241.72

basic_info

Product_Name: (1-((6-CHLOROPYRIMIDIN-4-YL)AMINO)CYCLOHEXYL)METHANOL
CAS: 1250521-81-3
EnglishSynonyms: (1-((6-CHLOROPYRIMIDIN-4-YL)AMINO)CYCLOHEXYL)METHANOL
pro_mdlNumber: MFCD16786167
pro_acceptors: 4
pro_donors: 2
pro_smile: c1c(ncnc1Cl)NC2(CCCCC2)CO
InChi: InChI=1S/C11H16ClN3O/c12-9-6-10(14-8-13-9)15-11(7-16)4-2-1-3-5-11/h6,8,16H,1-5,7H2,(H,13,14,15)
InChiKey: InChIKey=JMGFWIOBENNGEO-UHFFFAOYSA-N