5-(2,5-DIMETHYLBENZYL)-1,3,4-OXADIAZOL-2-AMINE

pro_cas
1248099-58-2
pro_cdbregno
CCD03166791
pro_formula
C11 H13 N3 O
pro_molWeight
203.244

basic_info

Product_Name: 5-(2,5-DIMETHYLBENZYL)-1,3,4-OXADIAZOL-2-AMINE
CAS: 1248099-58-2
EnglishSynonyms: 5-[(2,5-DIMETHYLPHENYL)METHYL]-1,3,4-OXADIAZOL-2-AMINE ; 5-(2,5-DIMETHYLBENZYL)-1,3,4-OXADIAZOL-2-AMINE
pro_mdlNumber: MFCD16786697
pro_acceptors: 4
pro_donors: 1
pro_smile: Cc1ccc(c(c1)Cc2nnc(o2)N)C
InChi: InChI=1S/C11H13N3O/c1-7-3-4-8(2)9(5-7)6-10-13-14-11(12)15-10/h3-5H,6H2,1-2H3,(H2,12,14)
InChiKey: InChIKey=SPZQDDCDFJMGLF-UHFFFAOYSA-N